C20H36O2 — CID 87439428
(2E)-3,7-dimethylocta-2,6-dienal;5-methyl-2-propan-2-ylcyclohexan-1-ol (PubChem CID 87439428) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is (2E)-3,7-dimethylocta-2,6-dienal;5-methyl-2-propan-2-ylcyclohexan-1-ol.
| Compound Name | (2E)-3,7-dimethylocta-2,6-dienal;5-methyl-2-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 87439428 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | (2E)-3,7-dimethylocta-2,6-dienal;5-methyl-2-propan-2-ylcyclohexan-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/C=O.CC1CCC(C(C)C)C(O)C1 |
| InChI | InChI=1S/C10H20O.C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11;1-9(2)5-4-6-10(3)7-8-11/h7-11H,4-6H2,1-3H3;5,7-8H,4,6H2,1-3H3/b;10-7+ |
| InChIKey | VQXIWLGQWKSSBS-FXRCEOBJSA-N |
| XLogP | 5.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|