About 5-methyl-2-propan-2-ylcyclohexan-1-ol;undec-10-enoic acid;zinc
5-methyl-2-propan-2-ylcyclohexan-1-ol;undec-10-enoic acid;zinc (PubChem CID 70506302) has the molecular formula C21H40O3Zn
and a molecular weight of 405.94 g/mol. Its IUPAC name is 5-methyl-2-propan-2-ylcyclohexan-1-ol;undec-10-enoic acid;zinc.
Molecular Properties
| Compound Name | 5-methyl-2-propan-2-ylcyclohexan-1-ol;undec-10-enoic acid;zinc |
| PubChem CID | 70506302 |
| Molecular Formula | C21H40O3Zn |
| Molecular Weight | 405.94 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 5-methyl-2-propan-2-ylcyclohexan-1-ol;undec-10-enoic acid;zinc |
| SMILES | C=CCCCCCCCCC(=O)O.CC1CCC(C(C)C)C(O)C1.[Zn] |
| InChI | InChI=1S/C11H20O2.C10H20O.Zn/c1-2-3-4-5-6-7-8-9-10-11(12)13;1-7(2)9-5-4-8(3)6-10(9)11;/h2H,1,3-10H2,(H,12,13);7-11H,4-6H2,1-3H3; |
| InChIKey | ROKYQLULGBFZMK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.94 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-propan-2-ylcyclohexan-1-ol;undec-10-enoic acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-propan-2-ylcyclohexan-1-ol;undec-10-enoic acid;zinc?
The IUPAC name of 5-methyl-2-propan-2-ylcyclohexan-1-ol;undec-10-enoic acid;zinc (CID 70506302) is 5-methyl-2-propan-2-ylcyclohexan-1-ol;undec-10-enoic acid;zinc.
What is the SMILES notation for 5-methyl-2-propan-2-ylcyclohexan-1-ol;undec-10-enoic acid;zinc?
The canonical SMILES for 5-methyl-2-propan-2-ylcyclohexan-1-ol;undec-10-enoic acid;zinc is C=CCCCCCCCCC(=O)O.CC1CCC(C(C)C)C(O)C1.[Zn].
What is the InChIKey of 5-methyl-2-propan-2-ylcyclohexan-1-ol;undec-10-enoic acid;zinc?
The InChIKey is ROKYQLULGBFZMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2.C10H20O.Zn/c1-2-3-4-5-6-7-8-9-10-11(12)13;1-7(2)9-5-4-8(3)6-10(9)11;/h2H,1,3-10H2,(H,12,13);7-11H,4-6H2,1-3H3;.
What are the key properties of 5-methyl-2-propan-2-ylcyclohexan-1-ol;undec-10-enoic acid;zinc?
5-methyl-2-propan-2-ylcyclohexan-1-ol;undec-10-enoic acid;zinc has a molecular weight of 405.94 g/mol, XLogP of 5.81, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-propan-2-ylcyclohexan-1-ol;undec-10-enoic acid;zinc is sourced from PubChem (CID 70506302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).