About alumane;undec-10-enoic acid;hydrochloride
alumane;undec-10-enoic acid;hydrochloride (PubChem CID 175378056) has the molecular formula C11H24AlClO2
and a molecular weight of 250.75 g/mol. Its IUPAC name is alumane;undec-10-enoic acid;hydrochloride.
Molecular Properties
| Compound Name | alumane;undec-10-enoic acid;hydrochloride |
| PubChem CID | 175378056 |
| Molecular Formula | C11H24AlClO2 |
| Molecular Weight | 250.75 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | alumane;undec-10-enoic acid;hydrochloride |
| SMILES | C=CCCCCCCCCC(=O)O.Cl.[AlH3] |
| InChI | InChI=1S/C11H20O2.Al.ClH.3H/c1-2-3-4-5-6-7-8-9-10-11(12)13;;;;;/h2H,1,3-10H2,(H,12,13);;1H;;; |
| InChIKey | RTYYYPGSMMWQTB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.75 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze alumane;undec-10-enoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;undec-10-enoic acid;hydrochloride?
The IUPAC name of alumane;undec-10-enoic acid;hydrochloride (CID 175378056) is alumane;undec-10-enoic acid;hydrochloride.
What is the SMILES notation for alumane;undec-10-enoic acid;hydrochloride?
The canonical SMILES for alumane;undec-10-enoic acid;hydrochloride is C=CCCCCCCCCC(=O)O.Cl.[AlH3].
What is the InChIKey of alumane;undec-10-enoic acid;hydrochloride?
The InChIKey is RTYYYPGSMMWQTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2.Al.ClH.3H/c1-2-3-4-5-6-7-8-9-10-11(12)13;;;;;/h2H,1,3-10H2,(H,12,13);;1H;;;.
What are the key properties of alumane;undec-10-enoic acid;hydrochloride?
alumane;undec-10-enoic acid;hydrochloride has a molecular weight of 250.75 g/mol, XLogP of 2.62, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;undec-10-enoic acid;hydrochloride is sourced from PubChem (CID 175378056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).