C17H30O2 — CID 91393607
heptadeca-12,16-dienoic acid (PubChem CID 91393607) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is heptadeca-12,16-dienoic acid.
| Compound Name | heptadeca-12,16-dienoic acid |
|---|---|
| PubChem CID | 91393607 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | heptadeca-12,16-dienoic acid |
| SMILES | C=CCCC=CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C17H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19/h2,5-6H,1,3-4,7-16H2,(H,18,19) |
| InChIKey | DJPJIMVUISFALP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|