About hypochlorous acid;5-methyl-2-propan-2-ylcyclohexan-1-ol
hypochlorous acid;5-methyl-2-propan-2-ylcyclohexan-1-ol (PubChem CID 174568794) has the molecular formula C10H21ClO2
and a molecular weight of 208.73 g/mol. Its IUPAC name is hypochlorous acid;5-methyl-2-propan-2-ylcyclohexan-1-ol.
Molecular Properties
| Compound Name | hypochlorous acid;5-methyl-2-propan-2-ylcyclohexan-1-ol |
| PubChem CID | 174568794 |
| Molecular Formula | C10H21ClO2 |
| Molecular Weight | 208.73 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | hypochlorous acid;5-methyl-2-propan-2-ylcyclohexan-1-ol |
| SMILES | CC1CCC(C(C)C)C(O)C1.OCl |
| InChI | InChI=1S/C10H20O.ClHO/c1-7(2)9-5-4-8(3)6-10(9)11;1-2/h7-11H,4-6H2,1-3H3;2H |
| InChIKey | VZSYGHCEYLAQCN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.73 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze hypochlorous acid;5-methyl-2-propan-2-ylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hypochlorous acid;5-methyl-2-propan-2-ylcyclohexan-1-ol?
The IUPAC name of hypochlorous acid;5-methyl-2-propan-2-ylcyclohexan-1-ol (CID 174568794) is hypochlorous acid;5-methyl-2-propan-2-ylcyclohexan-1-ol.
What is the SMILES notation for hypochlorous acid;5-methyl-2-propan-2-ylcyclohexan-1-ol?
The canonical SMILES for hypochlorous acid;5-methyl-2-propan-2-ylcyclohexan-1-ol is CC1CCC(C(C)C)C(O)C1.OCl.
What is the InChIKey of hypochlorous acid;5-methyl-2-propan-2-ylcyclohexan-1-ol?
The InChIKey is VZSYGHCEYLAQCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O.ClHO/c1-7(2)9-5-4-8(3)6-10(9)11;1-2/h7-11H,4-6H2,1-3H3;2H.
What are the key properties of hypochlorous acid;5-methyl-2-propan-2-ylcyclohexan-1-ol?
hypochlorous acid;5-methyl-2-propan-2-ylcyclohexan-1-ol has a molecular weight of 208.73 g/mol, XLogP of 2.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hypochlorous acid;5-methyl-2-propan-2-ylcyclohexan-1-ol is sourced from PubChem (CID 174568794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).