About dodecanoic acid;5-methyl-2-propan-2-ylcyclohexan-1-ol
dodecanoic acid;5-methyl-2-propan-2-ylcyclohexan-1-ol (PubChem CID 122703177) has the molecular formula C22H44O3
and a molecular weight of 356.59 g/mol. Its IUPAC name is dodecanoic acid;5-methyl-2-propan-2-ylcyclohexan-1-ol.
Molecular Properties
| Compound Name | dodecanoic acid;5-methyl-2-propan-2-ylcyclohexan-1-ol |
| PubChem CID | 122703177 |
| Molecular Formula | C22H44O3 |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.33 |
| IUPAC Name | dodecanoic acid;5-methyl-2-propan-2-ylcyclohexan-1-ol |
| SMILES | CC1CCC(C(C)C)C(O)C1.CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C12H24O2.C10H20O/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-7(2)9-5-4-8(3)6-10(9)11/h2-11H2,1H3,(H,13,14);7-11H,4-6H2,1-3H3 |
| InChIKey | CVPLPQGOSPKSFG-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecanoic acid;5-methyl-2-propan-2-ylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecanoic acid;5-methyl-2-propan-2-ylcyclohexan-1-ol?
The IUPAC name of dodecanoic acid;5-methyl-2-propan-2-ylcyclohexan-1-ol (CID 122703177) is dodecanoic acid;5-methyl-2-propan-2-ylcyclohexan-1-ol.
What is the SMILES notation for dodecanoic acid;5-methyl-2-propan-2-ylcyclohexan-1-ol?
The canonical SMILES for dodecanoic acid;5-methyl-2-propan-2-ylcyclohexan-1-ol is CC1CCC(C(C)C)C(O)C1.CCCCCCCCCCCC(=O)O.
What is the InChIKey of dodecanoic acid;5-methyl-2-propan-2-ylcyclohexan-1-ol?
The InChIKey is CVPLPQGOSPKSFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2.C10H20O/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-7(2)9-5-4-8(3)6-10(9)11/h2-11H2,1H3,(H,13,14);7-11H,4-6H2,1-3H3.
What are the key properties of dodecanoic acid;5-methyl-2-propan-2-ylcyclohexan-1-ol?
dodecanoic acid;5-methyl-2-propan-2-ylcyclohexan-1-ol has a molecular weight of 356.59 g/mol, XLogP of 6.43, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodecanoic acid;5-methyl-2-propan-2-ylcyclohexan-1-ol is sourced from PubChem (CID 122703177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).