C20H43NO3 — CID 174815812
methoxymethane;2-methylheptanamide;5-methyl-2-propan-2-ylcyclohexan-1-ol (PubChem CID 174815812) has the molecular formula C20H43NO3 and a molecular weight of 345.57 g/mol. Its IUPAC name is methoxymethane;2-methylheptanamide;5-methyl-2-propan-2-ylcyclohexan-1-ol.
| Compound Name | methoxymethane;2-methylheptanamide;5-methyl-2-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 174815812 |
| Molecular Formula | C20H43NO3 |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 345.32 |
| IUPAC Name | methoxymethane;2-methylheptanamide;5-methyl-2-propan-2-ylcyclohexan-1-ol |
| SMILES | CC1CCC(C(C)C)C(O)C1.CCCCCC(C)C(N)=O.COC |
| InChI | InChI=1S/C10H20O.C8H17NO.C2H6O/c1-7(2)9-5-4-8(3)6-10(9)11;1-3-4-5-6-7(2)8(9)10;1-3-2/h7-11H,4-6H2,1-3H3;7H,3-6H2,1-2H3,(H2,9,10);1-2H3 |
| InChIKey | SGDMPGOREBYYMB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|