C19H33BrO3 — CID 10430406
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-(2-bromo-2-oxoethyl)heptanoate (PubChem CID 10430406) has the molecular formula C19H33BrO3 and a molecular weight of 389.37 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-(2-bromo-2-oxoethyl)heptanoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-(2-bromo-2-oxoethyl)heptanoate |
|---|---|
| PubChem CID | 10430406 |
| Molecular Formula | C19H33BrO3 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S)-2-(2-bromo-2-oxoethyl)heptanoate |
| SMILES | CCCCC[C@@H](CC(=O)Br)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C19H33BrO3/c1-5-6-7-8-15(12-18(20)21)19(22)23-17-11-14(4)9-10-16(17)13(2)3/h13-17H,5-12H2,1-4H3/t14-,15+,16+,17-/m1/s1 |
| InChIKey | ALJAUTOKCNCVTA-LTIDMASMSA-N |
| XLogP | 5.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|