C16H31NO2 — CID 58715353
[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] N-pentylcarbamate (PubChem CID 58715353) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] N-pentylcarbamate.
| Compound Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] N-pentylcarbamate |
|---|---|
| PubChem CID | 58715353 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] N-pentylcarbamate |
| SMILES | CCCCCNC(=O)O[C@H]1C[C@@H](C)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C16H31NO2/c1-5-6-7-10-17-16(18)19-15-11-13(4)8-9-14(15)12(2)3/h12-15H,5-11H2,1-4H3,(H,17,18)/t13-,14+,15-/m0/s1 |
| InChIKey | NUNDBFKCSPKBBF-ZNMIVQPWSA-N |
| XLogP | 4.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|