C19H37NO2 — CID 91726626
(5-methyl-2-propan-2-ylcyclohexyl) N-octylcarbamate (PubChem CID 91726626) has the molecular formula C19H37NO2 and a molecular weight of 311.51 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) N-octylcarbamate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) N-octylcarbamate |
|---|---|
| PubChem CID | 91726626 |
| Molecular Formula | C19H37NO2 |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.28 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) N-octylcarbamate |
| SMILES | CCCCCCCCNC(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C19H37NO2/c1-5-6-7-8-9-10-13-20-19(21)22-18-14-16(4)11-12-17(18)15(2)3/h15-18H,5-14H2,1-4H3,(H,20,21) |
| InChIKey | ZHTXVIVBETUOBB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|