C21H41NO — CID 154148941
N-decyl-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 154148941) has the molecular formula C21H41NO and a molecular weight of 323.57 g/mol. Its IUPAC name is N-decyl-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | N-decyl-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 154148941 |
| Molecular Formula | C21H41NO |
| Molecular Weight | 323.57 g/mol |
| Exact Mass | 323.32 |
| IUPAC Name | N-decyl-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | CCCCCCCCCCNC(=O)C1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C21H41NO/c1-5-6-7-8-9-10-11-12-15-22-21(23)20-16-18(4)13-14-19(20)17(2)3/h17-20H,5-16H2,1-4H3,(H,22,23) |
| InChIKey | RTHPMIOBWYBLIH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|