C17H35ClN2O — CID 140775988
N-(6-aminohexyl)-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide;hydrochloride (PubChem CID 140775988) has the molecular formula C17H35ClN2O and a molecular weight of 318.93 g/mol. Its IUPAC name is N-(6-aminohexyl)-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide;hydrochloride.
| Compound Name | N-(6-aminohexyl)-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 140775988 |
| Molecular Formula | C17H35ClN2O |
| Molecular Weight | 318.93 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | N-(6-aminohexyl)-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide;hydrochloride |
| SMILES | CC1CCC(C(C)C)C(C(=O)NCCCCCCN)C1.Cl |
| InChI | InChI=1S/C17H34N2O.ClH/c1-13(2)15-9-8-14(3)12-16(15)17(20)19-11-7-5-4-6-10-18;/h13-16H,4-12,18H2,1-3H3,(H,19,20);1H |
| InChIKey | OIGQFHIERZYPNS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.93 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|