C11H21ClO2 — CID 66645461
5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid;hydrochloride (PubChem CID 66645461) has the molecular formula C11H21ClO2 and a molecular weight of 220.74 g/mol. Its IUPAC name is 5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid;hydrochloride.
| Compound Name | 5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 66645461 |
| Molecular Formula | C11H21ClO2 |
| Molecular Weight | 220.74 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid;hydrochloride |
| SMILES | CC1CCC(C(C)C)C(C(=O)O)C1.Cl |
| InChI | InChI=1S/C11H20O2.ClH/c1-7(2)9-5-4-8(3)6-10(9)11(12)13;/h7-10H,4-6H2,1-3H3,(H,12,13);1H |
| InChIKey | JASWGILUJKBCDM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.74 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |