C25H40O4 — CID 22468078
2,4-bis(5-methyl-2-propan-2-ylcyclohexyl)penta-2,3-dienedioic acid (PubChem CID 22468078) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is 2,4-bis(5-methyl-2-propan-2-ylcyclohexyl)penta-2,3-dienedioic acid.
| Compound Name | 2,4-bis(5-methyl-2-propan-2-ylcyclohexyl)penta-2,3-dienedioic acid |
|---|---|
| PubChem CID | 22468078 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | 2,4-bis(5-methyl-2-propan-2-ylcyclohexyl)penta-2,3-dienedioic acid |
| SMILES | CC1CCC(C(C)C)C(C(=C=C(C(=O)O)C2CC(C)CCC2C(C)C)C(=O)O)C1 |
| InChI | InChI=1S/C25H40O4/c1-14(2)18-9-7-16(5)11-20(18)22(24(26)27)13-23(25(28)29)21-12-17(6)8-10-19(21)15(3)4/h14-21H,7-12H2,1-6H3,(H,26,27)(H,28,29) |
| InChIKey | ALUSTEYVOVYCOJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|