C25H47NO4 — CID 91696177
nonyl 2-[(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylamino]pentanoate (PubChem CID 91696177) has the molecular formula C25H47NO4 and a molecular weight of 425.65 g/mol. Its IUPAC name is nonyl 2-[(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylamino]pentanoate.
| Compound Name | nonyl 2-[(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 91696177 |
| Molecular Formula | C25H47NO4 |
| Molecular Weight | 425.65 g/mol |
| Exact Mass | 425.35 |
| IUPAC Name | nonyl 2-[(5-methyl-2-propan-2-ylcyclohexyl)oxycarbonylamino]pentanoate |
| SMILES | CCCCCCCCCOC(=O)C(CCC)NC(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C25H47NO4/c1-6-8-9-10-11-12-13-17-29-24(27)22(14-7-2)26-25(28)30-23-18-20(5)15-16-21(23)19(3)4/h19-23H,6-18H2,1-5H3,(H,26,28) |
| InChIKey | ZHGXEWQTKQAGTP-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.65 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|