C14H26O2 — CID 175220199
butan-1-ol;3,7-dimethylocta-2,6-dienal (PubChem CID 175220199) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is butan-1-ol;3,7-dimethylocta-2,6-dienal.
| Compound Name | butan-1-ol;3,7-dimethylocta-2,6-dienal |
|---|---|
| PubChem CID | 175220199 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | butan-1-ol;3,7-dimethylocta-2,6-dienal |
| SMILES | CC(C)=CCCC(C)=CC=O.CCCCO |
| InChI | InChI=1S/C10H16O.C4H10O/c1-9(2)5-4-6-10(3)7-8-11;1-2-3-4-5/h5,7-8H,4,6H2,1-3H3;5H,2-4H2,1H3 |
| InChIKey | HCPCCGOWNZNHDZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|