C11H20N2OS — CID 175295951
3,7-dimethylocta-2,6-dienal;thiourea (PubChem CID 175295951) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is 3,7-dimethylocta-2,6-dienal;thiourea.
| Compound Name | 3,7-dimethylocta-2,6-dienal;thiourea |
|---|---|
| PubChem CID | 175295951 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 3,7-dimethylocta-2,6-dienal;thiourea |
| SMILES | CC(C)=CCCC(C)=CC=O.NC(N)=S |
| InChI | InChI=1S/C10H16O.CH4N2S/c1-9(2)5-4-6-10(3)7-8-11;2-1(3)4/h5,7-8H,4,6H2,1-3H3;(H4,2,3,4) |
| InChIKey | DDUFXSGHSYMVMM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|