C11H20N4 — CID 92524255
2-[(Z)-[(2Z)-3,7-dimethylocta-2,6-dienylidene]amino]guanidine (PubChem CID 92524255) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 2-[(Z)-[(2Z)-3,7-dimethylocta-2,6-dienylidene]amino]guanidine.
| Compound Name | 2-[(Z)-[(2Z)-3,7-dimethylocta-2,6-dienylidene]amino]guanidine |
|---|---|
| PubChem CID | 92524255 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 2-[(Z)-[(2Z)-3,7-dimethylocta-2,6-dienylidene]amino]guanidine |
| SMILES | CC(C)=CCC/C(C)=C\C=N/N=C(N)N |
| InChI | InChI=1S/C11H20N4/c1-9(2)5-4-6-10(3)7-8-14-15-11(12)13/h5,7-8H,4,6H2,1-3H3,(H4,12,13,15)/b10-7-,14-8- |
| InChIKey | NMAYRRIAIHEYOJ-WCZATXKWSA-N |
| XLogP | 1.94 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|