C30H56O3 — CID 67878390
3,7-dimethylocta-1,6-dien-3-ol;5-methyl-2-propan-2-ylcyclohexan-1-ol;(1R,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 67878390) has the molecular formula C30H56O3 and a molecular weight of 464.78 g/mol. Its IUPAC name is 3,7-dimethylocta-1,6-dien-3-ol;5-methyl-2-propan-2-ylcyclohexan-1-ol;(1R,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | 3,7-dimethylocta-1,6-dien-3-ol;5-methyl-2-propan-2-ylcyclohexan-1-ol;(1R,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 67878390 |
| Molecular Formula | C30H56O3 |
| Molecular Weight | 464.78 g/mol |
| Exact Mass | 464.42 |
| IUPAC Name | 3,7-dimethylocta-1,6-dien-3-ol;5-methyl-2-propan-2-ylcyclohexan-1-ol;(1R,2S,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | C=CC(C)(O)CCC=C(C)C.CC1(C)[C@@H]2CC[C@@]1(C)[C@@H](O)C2.CC1CCC(C(C)C)C(O)C1 |
| InChI | InChI=1S/C10H18O.C10H20O.C10H18O/c1-9(2)7-4-5-10(9,3)8(11)6-7;1-7(2)9-5-4-8(3)6-10(9)11;1-5-10(4,11)8-6-7-9(2)3/h7-8,11H,4-6H2,1-3H3;7-11H,4-6H2,1-3H3;5,7,11H,1,6,8H2,2-4H3/t7-,8+,10+;;/m1../s1 |
| InChIKey | CTGDETBNVJCICJ-PIOJDUODSA-N |
| XLogP | 7.30 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.78 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|