C10H20O2 — CID 91437445
(1S)-2-methyl-5-propan-2-ylcyclohexane-1,4-diol (PubChem CID 91437445) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is (1S)-2-methyl-5-propan-2-ylcyclohexane-1,4-diol.
| Compound Name | (1S)-2-methyl-5-propan-2-ylcyclohexane-1,4-diol |
|---|---|
| PubChem CID | 91437445 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | (1S)-2-methyl-5-propan-2-ylcyclohexane-1,4-diol |
| SMILES | CC(C)C1C[C@H](O)C(C)CC1O |
| InChI | InChI=1S/C10H20O2/c1-6(2)8-5-9(11)7(3)4-10(8)12/h6-12H,4-5H2,1-3H3/t7?,8?,9-,10?/m0/s1 |
| InChIKey | TXISQGBRDPUIBI-HTEYAMCKSA-N |
| XLogP | 1.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |