C9H18O3 — CID 157009791
(1R,2R,4S,5R)-5-propan-2-ylcyclohexane-1,2,4-triol (PubChem CID 157009791) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is (1R,2R,4S,5R)-5-propan-2-ylcyclohexane-1,2,4-triol.
| Compound Name | (1R,2R,4S,5R)-5-propan-2-ylcyclohexane-1,2,4-triol |
|---|---|
| PubChem CID | 157009791 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | (1R,2R,4S,5R)-5-propan-2-ylcyclohexane-1,2,4-triol |
| SMILES | CC(C)[C@H]1C[C@@H](O)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C9H18O3/c1-5(2)6-3-8(11)9(12)4-7(6)10/h5-12H,3-4H2,1-2H3/t6-,7+,8-,9-/m1/s1 |
| InChIKey | OBMLZGDTTDRNLZ-BZNPZCIMSA-N |
| XLogP | 0.14 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |