About trans-(1R,2S)-1-tert-butyl-2-propan-2-ylcyclopropane
trans-(1R,2S)-1-tert-butyl-2-propan-2-ylcyclopropane (PubChem CID 167553604) has the molecular formula C10H20
and a molecular weight of 140.27 g/mol. Its IUPAC name is trans-(1R,2S)-1-tert-butyl-2-propan-2-ylcyclopropane.
Analyze trans-(1R,2S)-1-tert-butyl-2-propan-2-ylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2S)-1-tert-butyl-2-propan-2-ylcyclopropane?
The IUPAC name of trans-(1R,2S)-1-tert-butyl-2-propan-2-ylcyclopropane (CID 167553604) is trans-(1R,2S)-1-tert-butyl-2-propan-2-ylcyclopropane.
What is the SMILES notation for trans-(1R,2S)-1-tert-butyl-2-propan-2-ylcyclopropane?
The canonical SMILES for trans-(1R,2S)-1-tert-butyl-2-propan-2-ylcyclopropane is CC(C)[C@@H]1C[C@H]1C(C)(C)C.
What is the InChIKey of trans-(1R,2S)-1-tert-butyl-2-propan-2-ylcyclopropane?
The InChIKey is CSLQJAWEQQWTKS-DTWKUNHWSA-N. The full InChI is InChI=1S/C10H20/c1-7(2)8-6-9(8)10(3,4)5/h7-9H,6H2,1-5H3/t8-,9+/m0/s1.
What are the key properties of trans-(1R,2S)-1-tert-butyl-2-propan-2-ylcyclopropane?
trans-(1R,2S)-1-tert-butyl-2-propan-2-ylcyclopropane has a molecular weight of 140.27 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2S)-1-tert-butyl-2-propan-2-ylcyclopropane is sourced from PubChem (CID 167553604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).