C18H36 — CID 140714074
1,3-ditert-butyl-5-methyl-2-propan-2-ylcyclohexane (PubChem CID 140714074) has the molecular formula C18H36 and a molecular weight of 252.49 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-methyl-2-propan-2-ylcyclohexane.
| Compound Name | 1,3-ditert-butyl-5-methyl-2-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 140714074 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | 1,3-ditert-butyl-5-methyl-2-propan-2-ylcyclohexane |
| SMILES | CC1CC(C(C)(C)C)C(C(C)C)C(C(C)(C)C)C1 |
| InChI | InChI=1S/C18H36/c1-12(2)16-14(17(4,5)6)10-13(3)11-15(16)18(7,8)9/h12-16H,10-11H2,1-9H3 |
| InChIKey | XXHXEDFKCVDDTL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |