C20H40O2 — CID 71251298
1,3-ditert-butyl-5-methyl-2-(2-propan-2-yloxyethoxy)cyclohexane (PubChem CID 71251298) has the molecular formula C20H40O2 and a molecular weight of 312.54 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-methyl-2-(2-propan-2-yloxyethoxy)cyclohexane.
| Compound Name | 1,3-ditert-butyl-5-methyl-2-(2-propan-2-yloxyethoxy)cyclohexane |
|---|---|
| PubChem CID | 71251298 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | 1,3-ditert-butyl-5-methyl-2-(2-propan-2-yloxyethoxy)cyclohexane |
| SMILES | CC1CC(C(C)(C)C)C(OCCOC(C)C)C(C(C)(C)C)C1 |
| InChI | InChI=1S/C20H40O2/c1-14(2)21-10-11-22-18-16(19(4,5)6)12-15(3)13-17(18)20(7,8)9/h14-18H,10-13H2,1-9H3 |
| InChIKey | LZHANZDATRASNR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|