C11H22O — CID 68635053
(1R,2S,5R)-2-tert-butyl-5-methylcyclohexan-1-ol (PubChem CID 68635053) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is (1R,2S,5R)-2-tert-butyl-5-methylcyclohexan-1-ol.
| Compound Name | (1R,2S,5R)-2-tert-butyl-5-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 68635053 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | (1R,2S,5R)-2-tert-butyl-5-methylcyclohexan-1-ol |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)C)[C@H](O)C1 |
| InChI | InChI=1S/C11H22O/c1-8-5-6-9(10(12)7-8)11(2,3)4/h8-10,12H,5-7H2,1-4H3/t8-,9-,10-/m1/s1 |
| InChIKey | OLSGPMSPGKZAEI-OPRDCNLKSA-N |
| XLogP | 2.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |