C14H26 — CID 123864296
1-tert-butyl-4-methyl-2-prop-1-en-2-ylcyclohexane (PubChem CID 123864296) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is 1-tert-butyl-4-methyl-2-prop-1-en-2-ylcyclohexane.
| Compound Name | 1-tert-butyl-4-methyl-2-prop-1-en-2-ylcyclohexane |
|---|---|
| PubChem CID | 123864296 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 1-tert-butyl-4-methyl-2-prop-1-en-2-ylcyclohexane |
| SMILES | C=C(C)C1CC(C)CCC1C(C)(C)C |
| InChI | InChI=1S/C14H26/c1-10(2)12-9-11(3)7-8-13(12)14(4,5)6/h11-13H,1,7-9H2,2-6H3 |
| InChIKey | IKDOVMJLXKWHGC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|