C11H20O — CID 146204600
[(2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl]methanol (PubChem CID 146204600) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is [(2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl]methanol.
| Compound Name | [(2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl]methanol |
|---|---|
| PubChem CID | 146204600 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | [(2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexyl]methanol |
| SMILES | C=C(C)[C@H]1CC[C@@H](C)CC1CO |
| InChI | InChI=1S/C11H20O/c1-8(2)11-5-4-9(3)6-10(11)7-12/h9-12H,1,4-7H2,2-3H3/t9-,10?,11-/m1/s1 |
| InChIKey | LURKLLBLHRMHJQ-GLYLRITDSA-N |
| XLogP | 2.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|