C18H36O2 — CID 70304538
hept-2-ene;methanol;5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 70304538) has the molecular formula C18H36O2 and a molecular weight of 284.48 g/mol. Its IUPAC name is hept-2-ene;methanol;5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | hept-2-ene;methanol;5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 70304538 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | hept-2-ene;methanol;5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C(C)C1CCC(C)CC1O.CC=CCCCC.CO |
| InChI | InChI=1S/C10H18O.C7H14.CH4O/c1-7(2)9-5-4-8(3)6-10(9)11;1-3-5-7-6-4-2;1-2/h8-11H,1,4-6H2,2-3H3;3,5H,4,6-7H2,1-2H3;2H,1H3 |
| InChIKey | GHECHXXIKZOQCE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|