C21H34O3 — CID 167092964
(2R,3R,4S,5R)-4-hydroxy-3-[(E)-3-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]but-2-enyl]-2-methyl-5-prop-1-en-2-ylcyclohexan-1-one (PubChem CID 167092964) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (2R,3R,4S,5R)-4-hydroxy-3-[(E)-3-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]but-2-enyl]-2-methyl-5-prop-1-en-2-ylcyclohexan-1-one.
| Compound Name | (2R,3R,4S,5R)-4-hydroxy-3-[(E)-3-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]but-2-enyl]-2-methyl-5-prop-1-en-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 167092964 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (2R,3R,4S,5R)-4-hydroxy-3-[(E)-3-[(1S,2R,4R)-2-hydroxy-4-methylcyclohexyl]but-2-enyl]-2-methyl-5-prop-1-en-2-ylcyclohexan-1-one |
| SMILES | C=C(C)[C@H]1CC(=O)[C@H](C)[C@@H](C/C=C(\C)[C@@H]2CC[C@@H](C)C[C@H]2O)[C@@H]1O |
| InChI | InChI=1S/C21H34O3/c1-12(2)18-11-19(22)15(5)17(21(18)24)9-7-14(4)16-8-6-13(3)10-20(16)23/h7,13,15-18,20-21,23-24H,1,6,8-11H2,2-5H3/b14-7+/t13-,15-,16+,17-,18-,20-,21+/m1/s1 |
| InChIKey | PUOYBFCWDGNBOX-KBOUPKTISA-N |
| XLogP | 3.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|