C15H28O3 — CID 53471029
3-methylbutanoic acid;5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 53471029) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is 3-methylbutanoic acid;5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | 3-methylbutanoic acid;5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 53471029 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 3-methylbutanoic acid;5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C(C)C1CCC(C)CC1O.CC(C)CC(=O)O |
| InChI | InChI=1S/C10H18O.C5H10O2/c1-7(2)9-5-4-8(3)6-10(9)11;1-4(2)3-5(6)7/h8-11H,1,4-6H2,2-3H3;4H,3H2,1-2H3,(H,6,7) |
| InChIKey | LTSXJBRPXPIBRU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|