C13H24O2 — CID 58788414
[(1R,2S,5R)-2-tert-butyl-5-methylcyclohexyl] acetate (PubChem CID 58788414) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is [(1R,2S,5R)-2-tert-butyl-5-methylcyclohexyl] acetate.
| Compound Name | [(1R,2S,5R)-2-tert-butyl-5-methylcyclohexyl] acetate |
|---|---|
| PubChem CID | 58788414 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | [(1R,2S,5R)-2-tert-butyl-5-methylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)C |
| InChI | InChI=1S/C13H24O2/c1-9-6-7-11(13(3,4)5)12(8-9)15-10(2)14/h9,11-12H,6-8H2,1-5H3/t9-,11-,12-/m1/s1 |
| InChIKey | PEOGCCDXNOXJOX-YUSALJHKSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |