C15H30 — CID 177164103
1-tert-butyl-2,5-dimethyl-4-propan-2-ylcyclohexane (PubChem CID 177164103) has the molecular formula C15H30 and a molecular weight of 210.40 g/mol. Its IUPAC name is 1-tert-butyl-2,5-dimethyl-4-propan-2-ylcyclohexane.
| Compound Name | 1-tert-butyl-2,5-dimethyl-4-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 177164103 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | 1-tert-butyl-2,5-dimethyl-4-propan-2-ylcyclohexane |
| SMILES | CC(C)C1CC(C)C(C(C)(C)C)CC1C |
| InChI | InChI=1S/C15H30/c1-10(2)13-8-12(4)14(9-11(13)3)15(5,6)7/h10-14H,8-9H2,1-7H3 |
| InChIKey | VCNYRQQDEOTBFX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |