C19H38 — CID 144658339
1-butan-2-yl-2,4-ditert-butyl-5-methylcyclohexane (PubChem CID 144658339) has the molecular formula C19H38 and a molecular weight of 266.51 g/mol. Its IUPAC name is 1-butan-2-yl-2,4-ditert-butyl-5-methylcyclohexane.
| Compound Name | 1-butan-2-yl-2,4-ditert-butyl-5-methylcyclohexane |
|---|---|
| PubChem CID | 144658339 |
| Molecular Formula | C19H38 |
| Molecular Weight | 266.51 g/mol |
| Exact Mass | 266.30 |
| IUPAC Name | 1-butan-2-yl-2,4-ditert-butyl-5-methylcyclohexane |
| SMILES | CCC(C)C1CC(C)C(C(C)(C)C)CC1C(C)(C)C |
| InChI | InChI=1S/C19H38/c1-10-13(2)15-11-14(3)16(18(4,5)6)12-17(15)19(7,8)9/h13-17H,10-12H2,1-9H3 |
| InChIKey | VDENXXWXBJIJBU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.51 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |