C19H40S — CID 144775424
1,3-ditert-butyl-2,5-dimethylcyclohexane;ethane;methanethione (PubChem CID 144775424) has the molecular formula C19H40S and a molecular weight of 300.60 g/mol. Its IUPAC name is 1,3-ditert-butyl-2,5-dimethylcyclohexane;ethane;methanethione.
| Compound Name | 1,3-ditert-butyl-2,5-dimethylcyclohexane;ethane;methanethione |
|---|---|
| PubChem CID | 144775424 |
| Molecular Formula | C19H40S |
| Molecular Weight | 300.60 g/mol |
| Exact Mass | 300.29 |
| IUPAC Name | 1,3-ditert-butyl-2,5-dimethylcyclohexane;ethane;methanethione |
| SMILES | C=S.CC.CC1CC(C(C)(C)C)C(C)C(C(C)(C)C)C1 |
| InChI | InChI=1S/C16H32.C2H6.CH2S/c1-11-9-13(15(3,4)5)12(2)14(10-11)16(6,7)8;2*1-2/h11-14H,9-10H2,1-8H3;1-2H3;1H2 |
| InChIKey | YZSQTMRNFBQHNC-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.60 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|