C13H26 — CID 59523055
2-tert-butyl-1,3,5-trimethylcyclohexane (PubChem CID 59523055) has the molecular formula C13H26 and a molecular weight of 182.35 g/mol. Its IUPAC name is 2-tert-butyl-1,3,5-trimethylcyclohexane.
| Compound Name | 2-tert-butyl-1,3,5-trimethylcyclohexane |
|---|---|
| PubChem CID | 59523055 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | 2-tert-butyl-1,3,5-trimethylcyclohexane |
| SMILES | CC1CC(C)C(C(C)(C)C)C(C)C1 |
| InChI | InChI=1S/C13H26/c1-9-7-10(2)12(11(3)8-9)13(4,5)6/h9-12H,7-8H2,1-6H3 |
| InChIKey | ZLJUAGXGZDSPQS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |