C7H13F — CID 169143039
cis-(1S,4R)-1-fluoro-2,4-dimethylcyclopentane (PubChem CID 169143039) has the molecular formula C7H13F and a molecular weight of 116.18 g/mol. Its IUPAC name is cis-(1S,4R)-1-fluoro-2,4-dimethylcyclopentane.
| Compound Name | cis-(1S,4R)-1-fluoro-2,4-dimethylcyclopentane |
|---|---|
| PubChem CID | 169143039 |
| Molecular Formula | C7H13F |
| Molecular Weight | 116.18 g/mol |
| Exact Mass | 116.10 |
| IUPAC Name | cis-(1S,4R)-1-fluoro-2,4-dimethylcyclopentane |
| SMILES | CC1C[C@@H](C)C[C@@H]1F |
| InChI | InChI=1S/C7H13F/c1-5-3-6(2)7(8)4-5/h5-7H,3-4H2,1-2H3/t5-,6?,7+/m1/s1 |
| InChIKey | NZNVXVKMMMAIAY-UYMSWOSGSA-N |
| XLogP | 2.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |