C7H12FI — CID 58246556
(1R,2R,4R)-1-fluoro-4-(iodomethyl)-2-methylcyclopentane (PubChem CID 58246556) has the molecular formula C7H12FI and a molecular weight of 242.07 g/mol. Its IUPAC name is (1R,2R,4R)-1-fluoro-4-(iodomethyl)-2-methylcyclopentane.
| Compound Name | (1R,2R,4R)-1-fluoro-4-(iodomethyl)-2-methylcyclopentane |
|---|---|
| PubChem CID | 58246556 |
| Molecular Formula | C7H12FI |
| Molecular Weight | 242.07 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | (1R,2R,4R)-1-fluoro-4-(iodomethyl)-2-methylcyclopentane |
| SMILES | C[C@@H]1C[C@@H](CI)C[C@H]1F |
| InChI | InChI=1S/C7H12FI/c1-5-2-6(4-9)3-7(5)8/h5-7H,2-4H2,1H3/t5-,6-,7-/m1/s1 |
| InChIKey | CDOLVJUEHMZAJK-FSDSQADBSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.07 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|