C6H9F2I — CID 59151255
cis-(1S,2R)-1,2-difluoro-4-(iodomethyl)cyclopentane (PubChem CID 59151255) has the molecular formula C6H9F2I and a molecular weight of 246.04 g/mol. Its IUPAC name is cis-(1S,2R)-1,2-difluoro-4-(iodomethyl)cyclopentane.
| Compound Name | cis-(1S,2R)-1,2-difluoro-4-(iodomethyl)cyclopentane |
|---|---|
| PubChem CID | 59151255 |
| Molecular Formula | C6H9F2I |
| Molecular Weight | 246.04 g/mol |
| Exact Mass | 245.97 |
| IUPAC Name | cis-(1S,2R)-1,2-difluoro-4-(iodomethyl)cyclopentane |
| SMILES | F[C@@H]1CC(CI)C[C@@H]1F |
| InChI | InChI=1S/C6H9F2I/c7-5-1-4(3-9)2-6(5)8/h4-6H,1-3H2/t4?,5-,6+ |
| InChIKey | YIPVJJIGRLHJGA-GOHHTPAQSA-N |
| XLogP | 2.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.04 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|