C12H20F2 — CID 140635472
1,6-difluoro-3,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 140635472) has the molecular formula C12H20F2 and a molecular weight of 202.29 g/mol. Its IUPAC name is 1,6-difluoro-3,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 1,6-difluoro-3,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 140635472 |
| Molecular Formula | C12H20F2 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1,6-difluoro-3,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CC1CC(F)C2CC(C)C(F)CC2C1 |
| InChI | InChI=1S/C12H20F2/c1-7-3-9-6-11(13)8(2)5-10(9)12(14)4-7/h7-12H,3-6H2,1-2H3 |
| InChIKey | RYRRGSBCMDYMSF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |