C6H11FO — CID 176837705
(1S,2S,4R)-2-fluoro-4-methylcyclopentan-1-ol (PubChem CID 176837705) has the molecular formula C6H11FO and a molecular weight of 118.15 g/mol. Its IUPAC name is (1S,2S,4R)-2-fluoro-4-methylcyclopentan-1-ol.
| Compound Name | (1S,2S,4R)-2-fluoro-4-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 176837705 |
| Molecular Formula | C6H11FO |
| Molecular Weight | 118.15 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | (1S,2S,4R)-2-fluoro-4-methylcyclopentan-1-ol |
| SMILES | C[C@@H]1C[C@H](O)[C@@H](F)C1 |
| InChI | InChI=1S/C6H11FO/c1-4-2-5(7)6(8)3-4/h4-6,8H,2-3H2,1H3/t4-,5-,6-/m0/s1 |
| InChIKey | JAWHBKGJBUMUKL-ZLUOBGJFSA-N |
| XLogP | 1.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.15 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |