C7H13FO — CID 126641319
(1R,2S,5R)-2-fluoro-5-methylcyclohexan-1-ol (PubChem CID 126641319) has the molecular formula C7H13FO and a molecular weight of 132.18 g/mol. Its IUPAC name is (1R,2S,5R)-2-fluoro-5-methylcyclohexan-1-ol.
| Compound Name | (1R,2S,5R)-2-fluoro-5-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 126641319 |
| Molecular Formula | C7H13FO |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.10 |
| IUPAC Name | (1R,2S,5R)-2-fluoro-5-methylcyclohexan-1-ol |
| SMILES | C[C@@H]1CC[C@H](F)[C@H](O)C1 |
| InChI | InChI=1S/C7H13FO/c1-5-2-3-6(8)7(9)4-5/h5-7,9H,2-4H2,1H3/t5-,6+,7-/m1/s1 |
| InChIKey | IVAQYKDBXLLSJG-DSYKOEDSSA-N |
| XLogP | 1.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |