C9H17O2 — CID 58391632
CID 58391632 (PubChem CID 58391632) has the molecular formula C9H17O2 and a molecular weight of 157.23 g/mol.
| Compound Name | CID 58391632 |
|---|---|
| PubChem CID | 58391632 |
| Molecular Formula | C9H17O2 |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | — |
| SMILES | C[CH]OC1CCC(C)CC1O |
| InChI | InChI=1S/C9H17O2/c1-3-11-9-5-4-7(2)6-8(9)10/h3,7-10H,4-6H2,1-2H3 |
| InChIKey | BAOBHUMLPSRIMF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |