C11H24O — CID 142087287
2,5-dimethylcyclohexan-1-ol;propane (PubChem CID 142087287) has the molecular formula C11H24O and a molecular weight of 172.31 g/mol. Its IUPAC name is 2,5-dimethylcyclohexan-1-ol;propane.
| Compound Name | 2,5-dimethylcyclohexan-1-ol;propane |
|---|---|
| PubChem CID | 142087287 |
| Molecular Formula | C11H24O |
| Molecular Weight | 172.31 g/mol |
| Exact Mass | 172.18 |
| IUPAC Name | 2,5-dimethylcyclohexan-1-ol;propane |
| SMILES | CC1CCC(C)C(O)C1.CCC |
| InChI | InChI=1S/C8H16O.C3H8/c1-6-3-4-7(2)8(9)5-6;1-3-2/h6-9H,3-5H2,1-2H3;3H2,1-2H3 |
| InChIKey | WYFWSJMOIYTFCG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |