C8H16KO+ — CID 18764424
potassium 2,5-dimethylcyclohexan-1-ol (PubChem CID 18764424) has the molecular formula C8H16KO+ and a molecular weight of 167.31 g/mol. Its IUPAC name is potassium 2,5-dimethylcyclohexan-1-ol.
| Compound Name | potassium 2,5-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 18764424 |
| Molecular Formula | C8H16KO+ |
| Molecular Weight | 167.31 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | potassium 2,5-dimethylcyclohexan-1-ol |
| SMILES | CC1CCC(C)C(O)C1.[K+] |
| InChI | InChI=1S/C8H16O.K/c1-6-3-4-7(2)8(9)5-6;/h6-9H,3-5H2,1-2H3;/q;+1 |
| InChIKey | WDOKBDHMSVMELT-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.31 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |