potassium 2,5-dimethylcyclohexan-1-ol

C8H16KO+ — CID 18764424

IUPACpotassium 2,5-dimethylcyclohexan-1-ol
SMILESCC1CCC(C)C(O)C1.[K+]
InChIInChI=1S/C8H16O.K/c1-6-3-4-7(2)8(9)5-6;/h6-9H,3-5H2,1-2H3;/q;+1
InChIKeyWDOKBDHMSVMELT-UHFFFAOYSA-N
MW167.31 g/mol
LogP-1.19
Rot. Bonds

About potassium 2,5-dimethylcyclohexan-1-ol

potassium 2,5-dimethylcyclohexan-1-ol (PubChem CID 18764424) has the molecular formula C8H16KO+ and a molecular weight of 167.31 g/mol. Its IUPAC name is potassium 2,5-dimethylcyclohexan-1-ol.

Molecular Properties

Compound Namepotassium 2,5-dimethylcyclohexan-1-ol
PubChem CID18764424
Molecular FormulaC8H16KO+
Molecular Weight167.31 g/mol
Exact Mass167.08
IUPAC Namepotassium 2,5-dimethylcyclohexan-1-ol
SMILESCC1CCC(C)C(O)C1.[K+]
InChIInChI=1S/C8H16O.K/c1-6-3-4-7(2)8(9)5-6;/h6-9H,3-5H2,1-2H3;/q;+1
InChIKeyWDOKBDHMSVMELT-UHFFFAOYSA-N
XLogP-1.19
TPSA20.23 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500167.31
LogP ≤ 5-1.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze potassium 2,5-dimethylcyclohexan-1-ol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 2,5-dimethylcyclohexan-1-ol?
The IUPAC name of potassium 2,5-dimethylcyclohexan-1-ol (CID 18764424) is potassium 2,5-dimethylcyclohexan-1-ol.
What is the SMILES notation for potassium 2,5-dimethylcyclohexan-1-ol?
The canonical SMILES for potassium 2,5-dimethylcyclohexan-1-ol is CC1CCC(C)C(O)C1.[K+].
What is the InChIKey of potassium 2,5-dimethylcyclohexan-1-ol?
The InChIKey is WDOKBDHMSVMELT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.K/c1-6-3-4-7(2)8(9)5-6;/h6-9H,3-5H2,1-2H3;/q;+1.
What are the key properties of potassium 2,5-dimethylcyclohexan-1-ol?
potassium 2,5-dimethylcyclohexan-1-ol has a molecular weight of 167.31 g/mol, XLogP of -1.19, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2,5-dimethylcyclohexan-1-ol is sourced from PubChem (CID 18764424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).