C8H16O — CID 143035345
(1S)-2,4-dimethylcyclohexan-1-ol (PubChem CID 143035345) has the molecular formula C8H16O and a molecular weight of 128.21 g/mol. Its IUPAC name is (1S)-2,4-dimethylcyclohexan-1-ol.
| Compound Name | (1S)-2,4-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 143035345 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.21 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | (1S)-2,4-dimethylcyclohexan-1-ol |
| SMILES | CC1CC[C@H](O)C(C)C1 |
| InChI | InChI=1S/C8H16O/c1-6-3-4-8(9)7(2)5-6/h6-9H,3-5H2,1-2H3/t6?,7?,8-/m0/s1 |
| InChIKey | CKPQAKDCQGMTSO-RRQHEKLDSA-N |
| XLogP | 1.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |