C12H21F — CID 155058601
1-cyclobutyl-4-fluoro-2,5-dimethylcyclohexane (PubChem CID 155058601) has the molecular formula C12H21F and a molecular weight of 184.30 g/mol. Its IUPAC name is 1-cyclobutyl-4-fluoro-2,5-dimethylcyclohexane.
| Compound Name | 1-cyclobutyl-4-fluoro-2,5-dimethylcyclohexane |
|---|---|
| PubChem CID | 155058601 |
| Molecular Formula | C12H21F |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 1-cyclobutyl-4-fluoro-2,5-dimethylcyclohexane |
| SMILES | CC1CC(C2CCC2)C(C)CC1F |
| InChI | InChI=1S/C12H21F/c1-8-7-12(13)9(2)6-11(8)10-4-3-5-10/h8-12H,3-7H2,1-2H3 |
| InChIKey | WHODLTXVWLUWMW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |