C11H19F — CID 134386503
(1S,2S,3R)-2-cyclobutyl-1-fluoro-3-methylcyclohexane (PubChem CID 134386503) has the molecular formula C11H19F and a molecular weight of 170.27 g/mol. Its IUPAC name is (1S,2S,3R)-2-cyclobutyl-1-fluoro-3-methylcyclohexane.
| Compound Name | (1S,2S,3R)-2-cyclobutyl-1-fluoro-3-methylcyclohexane |
|---|---|
| PubChem CID | 134386503 |
| Molecular Formula | C11H19F |
| Molecular Weight | 170.27 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | (1S,2S,3R)-2-cyclobutyl-1-fluoro-3-methylcyclohexane |
| SMILES | C[C@@H]1CCC[C@H](F)[C@@H]1C1CCC1 |
| InChI | InChI=1S/C11H19F/c1-8-4-2-7-10(12)11(8)9-5-3-6-9/h8-11H,2-7H2,1H3/t8-,10+,11+/m1/s1 |
| InChIKey | FIHZRFRBLJMZSQ-MIMYLULJSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.27 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |