C6H11B- — CID 134889664
CID 134889664 (PubChem CID 134889664) has the molecular formula C6H11B- and a molecular weight of 93.97 g/mol.
| Compound Name | CID 134889664 |
|---|---|
| PubChem CID | 134889664 |
| Molecular Formula | C6H11B- |
| Molecular Weight | 93.97 g/mol |
| Exact Mass | 94.10 |
| IUPAC Name | — |
| SMILES | [B-][C@@H]1CCC[C@H]1C |
| InChI | InChI=1S/C6H11B/c1-5-3-2-4-6(5)7/h5-6H,2-4H2,1H3/q-1/t5-,6-/m1/s1 |
| InChIKey | VWHUEBKXYNEKMA-PHDIDXHHSA-N |
| XLogP | 1.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 93.97 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|