C15H30 — CID 90824446
ethane;1,2,8-trimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 90824446) has the molecular formula C15H30 and a molecular weight of 210.40 g/mol. Its IUPAC name is ethane;1,2,8-trimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | ethane;1,2,8-trimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 90824446 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | ethane;1,2,8-trimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CC.CC1CCC2CCCC(C)C2C1C |
| InChI | InChI=1S/C13H24.C2H6/c1-9-7-8-12-6-4-5-10(2)13(12)11(9)3;1-2/h9-13H,4-8H2,1-3H3;1-2H3 |
| InChIKey | ILIXHQVCLBRLRJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |