C10H18 — CID 147576937
(6R)-1,6-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene (PubChem CID 147576937) has the molecular formula C10H18 and a molecular weight of 138.25 g/mol. Its IUPAC name is (6R)-1,6-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene.
| Compound Name | (6R)-1,6-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene |
|---|---|
| PubChem CID | 147576937 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | (6R)-1,6-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene |
| SMILES | CC1CCC2CC[C@@H](C)C12 |
| InChI | InChI=1S/C10H18/c1-7-3-5-9-6-4-8(2)10(7)9/h7-10H,3-6H2,1-2H3/t7-,8?,9?,10?/m1/s1 |
| InChIKey | FVQUHAPMFLWJHN-QVNBGCGHSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |